|
CAS#: 56-83-7 Product: 6-O-Phosphono-D-Fructose No suppilers available for the product. |
| Name | 6-O-Phosphono-D-Fructose |
|---|---|
| Synonyms | [2,3,4-tr |
| Molecular Structure | ![]() |
| Molecular Formula | C6H13O9P |
| Molecular Weight | 260.14 |
| CAS Registry Number | 56-83-7 |
| SMILES | C([C@H]([C@H]([C@@H](C(=O)CO)O)O)O)OP(=O)(O)O |
| InChI | 1S/C6H13O9P/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14/h4-7,9-11H,1-2H2,(H2,12,13,14)/t4-,5-,6-/m1/s1 |
| InChIKey | GSXOAOHZAIYLCY-HSUXUTPPSA-N |
| Density | 1.84g/cm3 (Cal.) |
|---|---|
| Boiling point | 697.652°C at 760 mmHg (Cal.) |
| Flash point | 375.727°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 6-O-Phosphono-D-Fructose |