Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 4-Bromo-alpha-Cyclopropyl-alpha-Methylbenzyl Alcohol |
|---|---|
| Synonyms | 1-(4-Bromophenyl)-1-Cyclopropyl-Ethanol; Nsc297313; 4-Bromo-Alpha-Cyclopropyl-Alpha-Methylbenzyl Alcohol |
| Molecular Structure |  |
| Molecular Formula | C11H13BrO |
| Molecular Weight | 241.13 |
| CAS Registry Number | 56041-75-9 |
| EINECS | 259-955-9 |
| SMILES | C2=C(C(C1CC1)(C)O)C=CC(=C2)Br |
| InChI | 1S/C11H13BrO/c1-11(13,8-2-3-8)9-4-6-10(12)7-5-9/h4-8,13H,2-3H2,1H3 |
| InChIKey | AKWHXCFLUPFEEX-UHFFFAOYSA-N |
| Density | 1.483g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.596°C at 760 mmHg (Cal.) |
| Flash point | 151.32°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Bromo-alpha-Cyclopropyl-alpha-Methylbenzyl Alcohol |