|
CAS#: 56047-14-4 Product: Rhodium(+2) Butanoate No suppilers available for the product. |
| Name | Rhodium(+2) Butanoate |
|---|---|
| Synonyms | Butyrate; Rhodium(+2) Cation; Butyric Acid, Rhodium(Ii) Salt; Rhodium Dibutyrate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H14O4Rh |
| Molecular Weight | 277.10 |
| CAS Registry Number | 56047-14-4 |
| SMILES | C(C([O-])=O)CC.C(C([O-])=O)CC.[Rh++] |
| InChI | 1S/2C4H8O2.Rh/c2*1-2-3-4(5)6;/h2*2-3H2,1H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | UJKGHGCNRPPHJM-UHFFFAOYSA-L |
| Boiling point | 164.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 69.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Rhodium(+2) Butanoate |