|
CAS#: 56052-18-7 Product: 3-Nitrophenyl Heptanoate No suppilers available for the product. |
| Name | 3-Nitrophenyl Heptanoate |
|---|---|
| Synonyms | 3-Nitrophenyl heptanoate # |
| Molecular Structure | ![]() |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 |
| CAS Registry Number | 56052-18-7 |
| SMILES | O=C(Oc1cccc(c1)[N+]([O-])=O)CCCCCC |
| InChI | 1S/C13H17NO4/c1-2-3-4-5-9-13(15)18-12-8-6-7-11(10-12)14(16)17/h6-8,10H,2-5,9H2,1H3 |
| InChIKey | AADGXNADXAEBPP-UHFFFAOYSA-N |
| Density | 1.135g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.051°C at 760 mmHg (Cal.) |
| Flash point | 139.953°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Nitrophenyl Heptanoate |