|
CAS#: 56079-11-9 Product: 4,4'-(2,2-Butanediyl)Bis(2-Chloroaniline) No suppilers available for the product. |
| Name | 4,4'-(2,2-Butanediyl)Bis(2-Chloroaniline) |
|---|---|
| Synonyms | 4-[1-(4-A |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18Cl2N2 |
| Molecular Weight | 309.23 |
| CAS Registry Number | 56079-11-9 |
| SMILES | Clc1cc(ccc1N)C(c2ccc(N)c(Cl)c2)(C)CC |
| InChI | 1S/C16H18Cl2N2/c1-3-16(2,10-4-6-14(19)12(17)8-10)11-5-7-15(20)13(18)9-11/h4-9H,3,19-20H2,1-2H3 |
| InChIKey | SFXBTVLZBMFRBF-UHFFFAOYSA-N |
| Density | 1.249g/cm3 (Cal.) |
|---|---|
| Boiling point | 424.739°C at 760 mmHg (Cal.) |
| Flash point | 210.675°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-(2,2-Butanediyl)Bis(2-Chloroaniline) |