|
CAS#: 56116-64-4 Product: Sodium N-(4-Chlorobenzoyl)-L-Tryptophanate No suppilers available for the product. |
| Name | Sodium N-(4-Chlorobenzoyl)-L-Tryptophanate |
|---|---|
| Synonyms | Sodium (2S)-2-[[(4-Chlorophenyl)-Oxomethyl]Amino]-3-(1H-Indol-3-Yl)Propanoate; Sodium (2S)-2-[(4-Chlorobenzoyl)Amino]-3-(1H-Indol-3-Yl)Propionate; Sodium (2S)-2-[(4-Chlorophenyl)Carbonylamino]-3-(1H-Indol-3-Yl)Propanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C18H14ClN2NaO3 |
| Molecular Weight | 364.76 |
| CAS Registry Number | 56116-64-4 |
| EINECS | 260-002-4 |
| SMILES | [C@H](NC(=O)C1=CC=C(Cl)C=C1)(CC2=C[NH]C3=CC=CC=C23)C([O-])=O.[Na+] |
| InChI | 1S/C18H15ClN2O3.Na/c19-13-7-5-11(6-8-13)17(22)21-16(18(23)24)9-12-10-20-15-4-2-1-3-14(12)15;/h1-8,10,16,20H,9H2,(H,21,22)(H,23,24);/q;+1/p-1/t16-;/m0./s1 |
| InChIKey | OFGMOCGAPXFVHA-NTISSMGPSA-M |
| Boiling point | 643.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 343.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium N-(4-Chlorobenzoyl)-L-Tryptophanate |