|
CAS#: 56177-41-4 Product: Methanetetrayltetrakis(trimethylstannane) No suppilers available for the product. |
| Name | Methanetetrayltetrakis(trimethylstannane) |
|---|---|
| Synonyms | Stannane, methanetetrayltetrakis*trimethyl-; Trimethyl[tris(trimethylstannyl)methyl]stannane # |
| Molecular Structure | ![]() |
| Molecular Formula | C13H36Sn4 |
| Molecular Weight | 667.26 |
| CAS Registry Number | 56177-41-4 |
| SMILES | C[Sn](C([Sn](C)(C)C)([Sn](C)(C)C)[Sn](C)(C)C)(C)C |
| InChI | 1S/12CH3.C.4Sn/h12*1H3;;;;; |
| InChIKey | ZNQMYLSLGIXRAA-UHFFFAOYSA-N |
| Boiling point | 366.66°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 179.77°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methanetetrayltetrakis(trimethylstannane) |