|
CAS#: 56181-61-4 Product: 4-(1-Bromo-2-Phenylethyl)-1,1'-Biphenyl No suppilers available for the product. |
| Name | 4-(1-Bromo-2-Phenylethyl)-1,1'-Biphenyl |
|---|---|
| Synonyms | 1-(1-Bromo-2-Phenyl-Ethyl)-4-Phenyl-Benzene; 4-(1-Bromo-2-Phenylethyl)-1,1'-Biphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C20H17Br |
| Molecular Weight | 337.26 |
| CAS Registry Number | 56181-61-4 |
| EINECS | 260-031-2 |
| SMILES | C2=C(C(CC1=CC=CC=C1)Br)C=CC(=C2)C3=CC=CC=C3 |
| InChI | 1S/C20H17Br/c21-20(15-16-7-3-1-4-8-16)19-13-11-18(12-14-19)17-9-5-2-6-10-17/h1-14,20H,15H2 |
| InChIKey | DGJADIBNFSHTMY-UHFFFAOYSA-N |
| Density | 1.286g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.714°C at 760 mmHg (Cal.) |
| Flash point | 195.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(1-Bromo-2-Phenylethyl)-1,1'-Biphenyl |