|
CAS#: 562-28-7 Product: Kaur-16-Ene No suppilers available for the product. |
| Name | Kaur-16-Ene |
|---|---|
| Synonyms | kaur-16-ene |
| Molecular Structure | ![]() |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.47 |
| CAS Registry Number | 562-28-7 |
| SMILES | C=C2\[C@H]1CC[C@H]3[C@](C1)(C2)CC[C@@H]4[C@]3(C)CCCC4(C)C |
| InChI | 1S/C20H32/c1-14-12-20-11-8-16-18(2,3)9-5-10-19(16,4)17(20)7-6-15(14)13-20/h15-17H,1,5-13H2,2-4H3/t15-,16-,17+,19-,20-/m0/s1 |
| InChIKey | ONVABDHFQKWOSV-GCLMUHHRSA-N |
| Density | 0.971g/cm3 (Cal.) |
|---|---|
| Boiling point | 346.948°C at 760 mmHg (Cal.) |
| Flash point | 170.327°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Kaur-16-Ene |