|
CAS#: 56222-78-7 Product: Valyl-Ochratoxin A No suppilers available for the product. |
| Name | Valyl-Ochratoxin A |
|---|---|
| Synonyms | (2S)-2-[[(3R)-5-Chloro-8-Hydroxy-3-Methyl-1-Oxo-Isochroman-7-Carbonyl]Amino]-3-Methyl-Butanoic Acid; (2S)-2-[[[(3R)-5-Chloro-8-Hydroxy-3-Methyl-1-Oxo-7-Isochromanyl]-Oxomethyl]Amino]-3-Methylbutanoic Acid; (2S)-2-[[(3R)-5-Chloro-8-Hydroxy-1-Keto-3-Methyl-Isochroman-7-Carbonyl]Amino]-3-Methyl-Butyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18ClNO6 |
| Molecular Weight | 355.77 |
| CAS Registry Number | 56222-78-7 |
| SMILES | [C@H](C(=O)O)(NC(=O)C2=CC(=C1C[C@H](OC(C1=C2O)=O)C)Cl)C(C)C |
| InChI | 1S/C16H18ClNO6/c1-6(2)12(15(21)22)18-14(20)9-5-10(17)8-4-7(3)24-16(23)11(8)13(9)19/h5-7,12,19H,4H2,1-3H3,(H,18,20)(H,21,22)/t7-,12+/m1/s1 |
| InChIKey | ANSGZDZCHNYETO-KRTXAFLBSA-N |
| Density | 1.39g/cm3 (Cal.) |
|---|---|
| Boiling point | 563.563°C at 760 mmHg (Cal.) |
| Flash point | 294.633°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Valyl-Ochratoxin A |