Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| DSL Chemicals (Shanghai) Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 (21) 6352-9955 | |||
|
info@dsl-chem.com | |||
| Chemical manufacturer since 1997 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 2-Acetylamino-6-Aminobenzoic acid |
|---|---|
| Synonyms | 2-Acetamido-6-Amino-Benzoic Acid; Benzoic Acid, 2-Acetamido-6-Amino-; Ccris 3030 |
| Molecular Structure |  |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 |
| CAS Registry Number | 5623-11-0 |
| SMILES | C1=C(NC(=O)C)C(=C(N)C=C1)C(=O)O |
| InChI | 1S/C9H10N2O3/c1-5(12)11-7-4-2-3-6(10)8(7)9(13)14/h2-4H,10H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | CSTPONPRTFVJLO-UHFFFAOYSA-N |
| Density | 1.414g/cm3 (Cal.) |
|---|---|
| Melting point | 184°C (Expl.) |
| Boiling point | 466.85°C at 760 mmHg (Cal.) |
| Flash point | 236.143°C (Cal.) |
| Safety Description | Safety glasses, adequate ventilation. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Acetylamino-6-Aminobenzoic acid |