|
CAS#: 5625-50-3 Product: 3-Isopropyl-6-(2-Methyl-Propyl)-2,5-Piperazinedione No suppilers available for the product. |
| Name | 3-Isopropyl-6-(2-Methyl-Propyl)-2,5-Piperazinedione |
|---|---|
| Synonyms | 3-Isobutyl-6-Isopropyl-Piperazine-2,5-Dione; 3-Isobutyl-6-Isopropylpiperazine-2,5-Dione; 3-Isobutyl-6-Isopropyl-Piperazine-2,5-Quinone |
| Molecular Structure | ![]() |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 |
| CAS Registry Number | 5625-50-3 |
| SMILES | C(C1NC(C(NC1=O)C(C)C)=O)C(C)C |
| InChI | 1S/C11H20N2O2/c1-6(2)5-8-10(14)13-9(7(3)4)11(15)12-8/h6-9H,5H2,1-4H3,(H,12,15)(H,13,14) |
| InChIKey | UPOUGDHEEGKEGS-UHFFFAOYSA-N |
| Density | 0.989g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.428°C at 760 mmHg (Cal.) |
| Flash point | 181.093°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Isopropyl-6-(2-Methyl-Propyl)-2,5-Piperazinedione |