|
CAS#: 56287-13-9 Product: 1,(N2)-Ethenoguanine No suppilers available for the product. |
| Name | 1,(N2)-Ethenoguanine |
|---|---|
| Synonyms | 9H-Imidazo(1,2-A)Purin-9-One, 1,4-Dihydro-; 1,(N2)-Ethenoguanine; 1,4-Dihydro-9H-Imidazo(1,2-A)Purin-9-One |
| Molecular Structure | ![]() |
| Molecular Formula | C7H5N5O |
| Molecular Weight | 175.15 |
| CAS Registry Number | 56287-13-9 |
| SMILES | C1=C[N]2C(=N1)NC3=C(C2=O)[NH]C=N3 |
| InChI | 1S/C7H5N5O/c13-6-4-5(10-3-9-4)11-7-8-1-2-12(6)7/h1-3H,(H,8,11)(H,9,10) |
| InChIKey | JAQUADIPBIOFCE-UHFFFAOYSA-N |
| Density | 2.022g/cm3 (Cal.) |
|---|---|
| Boiling point | 767.655°C at 760 mmHg (Cal.) |
| Flash point | 418.063°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,(N2)-Ethenoguanine |