|
CAS#: 56298-80-7 Product: 1-(1,1,5,5-Tetramethyl-1,2,3,5,6,7-Hexahydro-S-Indacen-4-Yl)Ethanone No suppilers available for the product. |
| Name | 1-(1,1,5,5-Tetramethyl-1,2,3,5,6,7-Hexahydro-S-Indacen-4-Yl)Ethanone |
|---|---|
| Synonyms | 1-(1,1,5, |
| Molecular Structure | ![]() |
| Molecular Formula | C18H24O |
| Molecular Weight | 256.38 |
| CAS Registry Number | 56298-80-7 |
| SMILES | O=C(c1c3c(cc2c1C(CC2)(C)C)C(CC3)(C)C)C |
| InChI | 1S/C18H24O/c1-11(19)15-13-7-9-17(2,3)14(13)10-12-6-8-18(4,5)16(12)15/h10H,6-9H2,1-5H3 |
| InChIKey | HTKLKCIIFZVPIO-UHFFFAOYSA-N |
| Density | 1.002g/cm3 (Cal.) |
|---|---|
| Boiling point | 357.778°C at 760 mmHg (Cal.) |
| Flash point | 151.47°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1,1,5,5-Tetramethyl-1,2,3,5,6,7-Hexahydro-S-Indacen-4-Yl)Ethanone |