|
CAS#: 56307-79-0 Product: Pentabromo-1,1'-Biphenyl No suppilers available for the product. |
| Name | Pentabromo-1,1'-Biphenyl |
|---|---|
| Synonyms | 1,1'-Biphenyl, Pentabromo-; Pentabromo-1,1'-Biphenyl; 1,1'-Biphenyl, 3,3',4,4',5-Pentabromo- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H5Br5 |
| Molecular Weight | 548.69 |
| CAS Registry Number | 56307-79-0 |
| SMILES | C1=C(C=C(C(=C1Br)Br)Br)C2=CC(=C(C=C2)Br)Br |
| InChI | 1S/C12H5Br5/c13-8-2-1-6(3-9(8)14)7-4-10(15)12(17)11(16)5-7/h1-5H |
| InChIKey | DGTPXLZCUVCFEH-UHFFFAOYSA-N |
| Density | 2.328g/cm3 (Cal.) |
|---|---|
| Boiling point | 461.02°C at 760 mmHg (Cal.) |
| Flash point | 224.35°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pentabromo-1,1'-Biphenyl |