|
CAS#: 5634-37-7 Product: Cloretate No suppilers available for the product. |
| Name | Cloretate |
|---|---|
| Synonyms | Carbonic Acid Bis(2,2,2-Trichloroethyl) Ester; Brn 1912457; Bis-(2,2,2-Trichlorethyl)Ester Kyseliny Uhlicite [Czech] |
| Molecular Structure | ![]() |
| Molecular Formula | C5H4Cl6O3 |
| Molecular Weight | 324.80 |
| CAS Registry Number | 5634-37-7 |
| SMILES | C(C(Cl)(Cl)Cl)OC(OCC(Cl)(Cl)Cl)=O |
| InChI | 1S/C5H4Cl6O3/c6-4(7,8)1-13-3(12)14-2-5(9,10)11/h1-2H2 |
| InChIKey | IEPBPSSCIZTJIF-UHFFFAOYSA-N |
| Density | 1.716g/cm3 (Cal.) |
|---|---|
| Boiling point | 331.376°C at 760 mmHg (Cal.) |
| Flash point | 135.946°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cloretate |