|
CAS#: 56348-21-1 Product: 3,3,7,7-Tetramethyl-5-(2-Methyl-1-Propen-1-Yl)Tricyclo[4.1.0.02,4]Heptane No suppilers available for the product. |
| Name | 3,3,7,7-Tetramethyl-5-(2-Methyl-1-Propen-1-Yl)Tricyclo[4.1.0.02,4]Heptane |
|---|---|
| Synonyms | Tricyclo[ |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 |
| CAS Registry Number | 56348-21-1 |
| SMILES | C(=C\C1C3C(C2C1C2(C)C)C3(C)C)(\C)C |
| InChI | 1S/C15H24/c1-8(2)7-9-10-12(14(10,3)4)13-11(9)15(13,5)6/h7,9-13H,1-6H3 |
| InChIKey | YWQFJLGHCMWPMY-UHFFFAOYSA-N |
| Density | 0.949g/cm3 (Cal.) |
|---|---|
| Boiling point | 236.473°C at 760 mmHg (Cal.) |
| Flash point | 87.831°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3,7,7-Tetramethyl-5-(2-Methyl-1-Propen-1-Yl)Tricyclo[4.1.0.02,4]Heptane |