| Name | 2,4,6-Tris(2,4,6-Tribromophenoxy)-1,3,5-Triazine |
|---|---|
| Synonyms | 2,4,6-Tris(2,4,6-Tribromophenoxy)-S-Triazine; Tris(Tribromophenoxy)-S-Triazine; 1,3,5-Triazine, 2,4,6-Tris(Tribromophenoxy)- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H6Br9N3O3 |
| Molecular Weight | 1067.43 |
| CAS Registry Number | 56362-01-7 |
| SMILES | C1=C(C=C(Br)C(=C1Br)OC2=NC(=NC(=N2)OC3=C(C=C(C=C3Br)Br)Br)OC4=C(C=C(C=C4Br)Br)Br)Br |
| InChI | 1S/C21H6Br9N3O3/c22-7-1-10(25)16(11(26)2-7)34-19-31-20(35-17-12(27)3-8(23)4-13(17)28)33-21(32-19)36-18-14(29)5-9(24)6-15(18)30/h1-6H |
| InChIKey | BDFBPPCACYFGFA-UHFFFAOYSA-N |
| Density | 2.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 812.2±75.0°C at 760 mmHg (Cal.) |
| Flash point | 445.0±37.1°C (Cal.) |
| (1) | F. Li, H.-Q. Jiang, X.-M. Li and S.-S. Zhang. 2,4,6-Tris(2,4,6-tribromophenoxy)-1,3,5-triazine, Acta Cryst. (2006). E62, o3303-o3304 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,4,6-Tris(2,4,6-Tribromophenoxy)-1,3,5-Triazine |