|
CAS#: 56418-85-0 Product: Dibenzofuran-2,8-Bis(Sulphonohydrazide) No suppilers available for the product. |
| Name | Dibenzofuran-2,8-Bis(Sulphonohydrazide) |
|---|---|
| Synonyms | Dibenzofuran-2,8-Bis(Sulphonohydrazide) |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12N4O5S2 |
| Molecular Weight | 356.37 |
| CAS Registry Number | 56418-85-0 |
| EINECS | 260-168-8 |
| SMILES | C2=C1C3=C(OC1=CC=C2[S](NN)(=O)=O)C=CC(=C3)[S](NN)(=O)=O |
| InChI | 1S/C12H12N4O5S2/c13-15-22(17,18)7-1-3-11-9(5-7)10-6-8(23(19,20)16-14)2-4-12(10)21-11/h1-6,15-16H,13-14H2 |
| InChIKey | UIUWCVSRSKMUET-UHFFFAOYSA-N |
| Density | 1.65g/cm3 (Cal.) |
|---|---|
| Boiling point | 666.68°C at 760 mmHg (Cal.) |
| Flash point | 356.996°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dibenzofuran-2,8-Bis(Sulphonohydrazide) |