|
CAS#: 56473-79-1 Product: 5-Methoxy-6-Methylindolin-2-One No suppilers available for the product. |
| Name | 5-Methoxy-6-Methylindolin-2-One |
|---|---|
| Synonyms | 5-Methoxy-6-Methyl-Indolin-2-One; 5-Methoxy-6-Methyl-2-Indolinone; 5-Methoxy-6-Methyl-Oxindole |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 |
| CAS Registry Number | 56473-79-1 |
| SMILES | C1=C(C(=CC2=C1NC(=O)C2)OC)C |
| InChI | 1S/C10H11NO2/c1-6-3-8-7(4-9(6)13-2)5-10(12)11-8/h3-4H,5H2,1-2H3,(H,11,12) |
| InChIKey | REYVKVBSIFNUOP-UHFFFAOYSA-N |
| Density | 1.171g/cm3 (Cal.) |
|---|---|
| Boiling point | 354.986°C at 760 mmHg (Cal.) |
| Flash point | 168.49°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methoxy-6-Methylindolin-2-One |