Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | Terbufibrol |
|---|---|
| Synonyms | 4-[3-(4-Tert-Butylphenoxy)-2-Hydroxy-Propoxy]Benzoic Acid; 4'-(3-(4'-T-Butylphenoxy)-2-Hydroxypropoxy)Benzoic Acid; 4-(3-(4-(1,1-Dimethylethyl)Phenoxy)-2-Hydroxypropoxy)Benzoic Acid |
| Molecular Structure |  |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 |
| CAS Registry Number | 56488-59-6 |
| SMILES | C1=C(C=CC(=C1)C(C)(C)C)OCC(COC2=CC=C(C=C2)C(O)=O)O |
| InChI | 1S/C20H24O5/c1-20(2,3)15-6-10-18(11-7-15)25-13-16(21)12-24-17-8-4-14(5-9-17)19(22)23/h4-11,16,21H,12-13H2,1-3H3,(H,22,23) |
| InChIKey | PXODZCMXOZRVEN-UHFFFAOYSA-N |
| Density | 1.18g/cm3 (Cal.) |
|---|---|
| Boiling point | 524.056°C at 760 mmHg (Cal.) |
| Flash point | 183.374°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Terbufibrol |