Online Database of Chemicals from Around the World
|
CAS#: 565-36-6 Product: 3-Amino-N-5-Chloropyrimidin-2-Ylbenzenesulphonamide No suppilers available for the product. |
| Name | 3-Amino-N-5-Chloropyrimidin-2-Ylbenzenesulphonamide |
|---|---|
| Synonyms | 3-Amino-N-(5-Chloro-2-Pyrimidinyl)Benzenesulfonamide; 3-Amino-N-5-Chloropyrimidin-2-Ylbenzenesulphonamide; 4-25-00-02121 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C10H9ClN4O2S |
| Molecular Weight | 284.72 |
| CAS Registry Number | 565-36-6 |
| EINECS | 209-277-4 |
| SMILES | C1=C(C=CC=C1[S](NC2=NC=C(Cl)C=N2)(=O)=O)N |
| InChI | 1S/C10H9ClN4O2S/c11-7-5-13-10(14-6-7)15-18(16,17)9-3-1-2-8(12)4-9/h1-6H,12H2,(H,13,14,15) |
| InChIKey | HWRUOPCDGPXWRR-UHFFFAOYSA-N |
| Density | 1.589g/cm3 (Cal.) |
|---|---|
| Boiling point | 554.851°C at 760 mmHg (Cal.) |
| Flash point | 289.363°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Amino-N-5-Chloropyrimidin-2-Ylbenzenesulphonamide |