|
CAS#: 56523-61-6 Product: (4S)-4-Amino-4-[[(1S)-4-Amino-1-Carboxy-Butyl]Carbamoyl]Butanoic Acid No suppilers available for the product. |
| Name | (4S)-4-Amino-4-[[(1S)-4-Amino-1-Carboxy-Butyl]Carbamoyl]Butanoic Acid |
|---|---|
| Synonyms | (4S)-4-Amino-5-[[(1S)-4-Amino-1-Carboxy-Butyl]Amino]-5-Oxo-Pentanoic Acid; (4S)-4-Amino-5-[[(1S)-4-Amino-1-Carboxybutyl]Amino]-5-Oxopentanoic Acid; (4S)-4-Amino-5-[[(1S)-4-Amino-1-Carboxy-Butyl]Amino]-5-Keto-Valeric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H19N3O5 |
| Molecular Weight | 261.28 |
| CAS Registry Number | 56523-61-6 |
| SMILES | [C@H](C(=O)O)(NC([C@@H](N)CCC(=O)O)=O)CCCN |
| InChI | 1S/C10H19N3O5/c11-5-1-2-7(10(17)18)13-9(16)6(12)3-4-8(14)15/h6-7H,1-5,11-12H2,(H,13,16)(H,14,15)(H,17,18)/t6-,7-/m0/s1 |
| InChIKey | FCQBDQYWNGUTPD-BQBZGAKWSA-N |
| Density | 1.327g/cm3 (Cal.) |
|---|---|
| Boiling point | 613.661°C at 760 mmHg (Cal.) |
| Flash point | 324.931°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4S)-4-Amino-4-[[(1S)-4-Amino-1-Carboxy-Butyl]Carbamoyl]Butanoic Acid |