|
CAS#: 56600-56-7 Product: 1,6-Diamino-7H-Benz[de]Anthracen-7-One No suppilers available for the product. |
| Name | 1,6-Diamino-7H-Benz[de]Anthracen-7-One |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C17H12N2O |
| Molecular Weight | 260.29 |
| CAS Registry Number | 56600-56-7 |
| EINECS | 260-277-0 |
| SMILES | C4=C2C1=C(C3=C(C(=O)C1=C(N)C=C2)C=CC=C3)C(=C4)N |
| InChI | 1S/C17H12N2O/c18-12-7-5-9-6-8-13(19)16-14(9)15(12)10-3-1-2-4-11(10)17(16)20/h1-8H,18-19H2 |
| InChIKey | BRSFNKPRNHRKAT-UHFFFAOYSA-N |
| Density | 1.418g/cm3 (Cal.) |
|---|---|
| Boiling point | 578.263°C at 760 mmHg (Cal.) |
| Flash point | 303.522°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,6-Diamino-7H-Benz[de]Anthracen-7-One |