|
CAS#: 5663-04-7 Product: 1,1,3-Triphenylurea No suppilers available for the product. |
| Name | 1,1,3-Triphenylurea |
|---|---|
| Synonyms | N,N,N'-Triphenylurea #; Triphenylurea; Triphenyl-urea |
| Molecular Structure | ![]() |
| Molecular Formula | C19H16N2O |
| Molecular Weight | 288.34 |
| CAS Registry Number | 5663-04-7 |
| SMILES | C1=CC=C(C=C1)NC(=O)N(C2=CC=CC=C2)C3=CC=CC=C3 |
| InChI | 1S/C19H16N2O/c22-19(20-16-10-4-1-5-11-16)21(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H,(H,20,22) |
| InChIKey | HKQGDIKHDDGEOE-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 486.5±18.0°C at 760 mmHg (Cal.) |
| Flash point | 248.0±21.2°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,1,3-Triphenylurea |