|
CAS#: 5664-09-5 Product: 4-Hydroxy-2,3,5,6-tetramethyl-2,5-Cyclohexadien-1-one No suppilers available for the product. |
| Name | 4-Hydroxy-2,3,5,6-tetramethyl-2,5-Cyclohexadien-1-one |
|---|---|
| Synonyms | 4-Hydroxy-2,3,5,6-Tetramethyl-Cyclohexa-2,5-Dien-1-One; 4-Hydroxy-2,3,5,6-Tetramethyl-1-Cyclohexa-2,5-Dienone; 2,5-Cyclohexadien-1-One, 4-Hydroxy-2,3,5,6-Tetramethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 |
| CAS Registry Number | 5664-09-5 |
| SMILES | CC1=C(C(C(=C(C1=O)C)C)O)C |
| InChI | 1S/C10H14O2/c1-5-6(2)10(12)8(4)7(3)9(5)11/h9,11H,1-4H3 |
| InChIKey | RMVJRVKBWWOYPN-UHFFFAOYSA-N |
| Density | 1.049g/cm3 (Cal.) |
|---|---|
| Boiling point | 294.103°C at 760 mmHg (Cal.) |
| Flash point | 123.829°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Hydroxy-2,3,5,6-tetramethyl-2,5-Cyclohexadien-1-one |