|
CAS#: 56666-87-6 Product: 1-(2,2-Dimethylpropyl)-2,4,5-Trimethylbenzene No suppilers available for the product. |
| Name | 1-(2,2-Dimethylpropyl)-2,4,5-Trimethylbenzene |
|---|---|
| Synonyms | 1,2,4-Trimethyl-5-neopentylbenzene # |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.32 |
| CAS Registry Number | 56666-87-6 |
| SMILES | c1c(c(cc(c1CC(C)(C)C)C)C)C |
| InChI | 1S/C14H22/c1-10-7-12(3)13(8-11(10)2)9-14(4,5)6/h7-8H,9H2,1-6H3 |
| InChIKey | OQQKZMVCVVOBPG-UHFFFAOYSA-N |
| Density | 0.863g/cm3 (Cal.) |
|---|---|
| Boiling point | 260.41°C at 760 mmHg (Cal.) |
| Flash point | 106.762°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(2,2-Dimethylpropyl)-2,4,5-Trimethylbenzene |