|
CAS#: 56705-75-0 Product: Potassium 2-Cyclohexylphenolate No suppilers available for the product. |
| Name | Potassium 2-Cyclohexylphenolate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H15KO |
| Molecular Weight | 214.35 |
| CAS Registry Number | 56705-75-0 |
| EINECS | 260-347-0 |
| SMILES | C1=CC=CC(=C1C2CCCCC2)[O-].[K+] |
| InChI | 1S/C12H16O.K/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h4-5,8-10,13H,1-3,6-7H2;/q;+1/p-1 |
| InChIKey | SNPSNYDZHXRPAG-UHFFFAOYSA-M |
| Boiling point | 238.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 113.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Potassium 2-Cyclohexylphenolate |