|
CAS#: 56840-61-0 Product: 2-[2-(3-Nitrophenyl)hydrazinylidene]Propanedioic acid No suppilers available for the product. |
| Name | 2-[2-(3-Nitrophenyl)hydrazinylidene]Propanedioic acid |
|---|---|
| Synonyms | 2-[(3-Nitrophenyl)Hydrazono]Propanedioic Acid; 2-[(3-Nitrophenyl)Hydrazono]Malonic Acid; Romucide |
| Molecular Structure | ![]() |
| Molecular Formula | C9H7N3O6 |
| Molecular Weight | 253.17 |
| CAS Registry Number | 56840-61-0 |
| SMILES | C1=C(NN=C(C(=O)O)C(=O)O)C=CC=C1[N+]([O-])=O |
| InChI | 1S/C9H7N3O6/c13-8(14)7(9(15)16)11-10-5-2-1-3-6(4-5)12(17)18/h1-4,10H,(H,13,14)(H,15,16) |
| InChIKey | ZIWXVQKFPSEGNN-UHFFFAOYSA-N |
| Density | 1.655g/cm3 (Cal.) |
|---|---|
| Boiling point | 505.839°C at 760 mmHg (Cal.) |
| Flash point | 259.722°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[2-(3-Nitrophenyl)hydrazinylidene]Propanedioic acid |