|
CAS#: 56858-70-9 Product: 2-Chloro-[1,1-Biphenyl]-4,4'-Diol No suppilers available for the product. |
| Name | 2-Chloro-[1,1-Biphenyl]-4,4'-Diol |
|---|---|
| Synonyms | (1,1'-Biphenyl)-4,4'-Diol, 2-Chloro-; 4,4'-Dihydroxy-2'-Chlorobiphenyl; 2-Chloro-1,1'-Biphenyl-4,4'-Diol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9ClO2 |
| Molecular Weight | 220.65 |
| CAS Registry Number | 56858-70-9 |
| SMILES | C1=CC(=CC=C1O)C2=C(C=C(C=C2)O)Cl |
| InChI | 1S/C12H9ClO2/c13-12-7-10(15)5-6-11(12)8-1-3-9(14)4-2-8/h1-7,14-15H |
| InChIKey | SDDOUBZCBHJDLO-UHFFFAOYSA-N |
| Density | 1.349g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.301°C at 760 mmHg (Cal.) |
| Flash point | 172.309°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-[1,1-Biphenyl]-4,4'-Diol |