|
CAS#: 56911-75-2 Product: 5-Chloro-3-Ethyl-2-Methoxybenzyl Alcohol No suppilers available for the product. |
| Name | 5-Chloro-3-Ethyl-2-Methoxybenzyl Alcohol |
|---|---|
| Synonyms | (5-Chloro-3-Ethyl-2-Methoxy-Phenyl)Methanol; 5-Chlor-2-Methoxy-3-Aethylbenzylalkohol [German]; 5-Chloro-3-Ethyl-2-Methoxybenzenemethanol |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13ClO2 |
| Molecular Weight | 200.66 |
| CAS Registry Number | 56911-75-2 |
| SMILES | C1=C(C=C(C(=C1CC)OC)CO)Cl |
| InChI | 1S/C10H13ClO2/c1-3-7-4-9(11)5-8(6-12)10(7)13-2/h4-5,12H,3,6H2,1-2H3 |
| InChIKey | CURKESUTRPIYLA-UHFFFAOYSA-N |
| Density | 1.166g/cm3 (Cal.) |
|---|---|
| Boiling point | 285.721°C at 760 mmHg (Cal.) |
| Flash point | 126.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Chloro-3-Ethyl-2-Methoxybenzyl Alcohol |