|
CAS#: 56943-68-1 Product: Dichloro-7H-Benz[de]Anthracen-7-One No suppilers available for the product. |
| Name | Dichloro-7H-Benz[de]Anthracen-7-One |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C17H8Cl2O |
| Molecular Weight | 299.16 |
| CAS Registry Number | 56943-68-1 |
| EINECS | 260-460-5 |
| SMILES | C2=C(C(=C1C(C4=C(C3=C1C2=CC=C3)C=CC=C4)=O)Cl)Cl |
| InChI | 1S/C17H8Cl2O/c18-13-8-9-4-3-7-11-10-5-1-2-6-12(10)17(20)15(14(9)11)16(13)19/h1-8H |
| InChIKey | SMMDPESILPXSFJ-UHFFFAOYSA-N |
| Density | 1.475g/cm3 (Cal.) |
|---|---|
| Boiling point | 515.399°C at 760 mmHg (Cal.) |
| Flash point | 215.335°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dichloro-7H-Benz[de]Anthracen-7-One |