|
CAS#: 56961-23-0 Product: Trichlorophloroglucinol No suppilers available for the product. |
| Name | Trichlorophloroglucinol |
|---|---|
| Synonyms | 2,4,6-Trichlorophloroglucinol; Phloroglucinol, Trichloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H3Cl3O3 |
| Molecular Weight | 229.45 |
| CAS Registry Number | 56961-23-0 |
| EINECS | 260-467-3 |
| SMILES | C1(=C(C(=C(C(=C1O)Cl)O)Cl)O)Cl |
| InChI | 1S/C6H3Cl3O3/c7-1-4(10)2(8)6(12)3(9)5(1)11/h10-12H |
| InChIKey | MHKCQYLJFGNSQZ-UHFFFAOYSA-N |
| Density | 1.903g/cm3 (Cal.) |
|---|---|
| Boiling point | 304.676°C at 760 mmHg (Cal.) |
| Flash point | 138.063°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trichlorophloroglucinol |