|
CAS#: 5698-52-2 Product: (2Z)4,6-Dioxooct-2-Enedioic Acid No suppilers available for the product. |
| Name | (2Z)4,6-Dioxooct-2-Enedioic Acid |
|---|---|
| Synonyms | (Z)-4,6-Diketooct-2-Enedioic Acid; 4-Maleylacetoacetic Acid; C01036 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8O6 |
| Molecular Weight | 200.15 |
| CAS Registry Number | 5698-52-2 |
| SMILES | C(C(CC(O)=O)=O)C(\C=C/C(O)=O)=O |
| InChI | 1S/C8H8O6/c9-5(1-2-7(11)12)3-6(10)4-8(13)14/h1-2H,3-4H2,(H,11,12)(H,13,14)/b2-1- |
| InChIKey | GACSIVHAIFQKTC-UPHRSURJSA-N |
| Density | 1.454g/cm3 (Cal.) |
|---|---|
| Boiling point | 478.209°C at 760 mmHg (Cal.) |
| Flash point | 257.122°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2Z)4,6-Dioxooct-2-Enedioic Acid |