|
CAS#: 570-30-9 Product: 1,3,5(10)-Estratrien-3,15-alpha,17-beta-Triol No suppilers available for the product. |
| Name | 1,3,5(10)-Estratrien-3,15-alpha,17-beta-Triol |
|---|---|
| Synonyms | 15Alpha-Hydroxyestradiol; Estra-1,3,5(10)-Triene-3,15Alpha,17-Triol |
| Molecular Structure | ![]() |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 |
| CAS Registry Number | 570-30-9 |
| SMILES | [C@@H]23CCC1=C(C=CC(=C1)O)[C@H]2CC[C@]4([C@H]3[C@H](C[C@@H]4O)O)C |
| InChI | 1S/C18H24O3/c1-18-7-6-13-12-5-3-11(19)8-10(12)2-4-14(13)17(18)15(20)9-16(18)21/h3,5,8,13-17,19-21H,2,4,6-7,9H2,1H3/t13-,14-,15+,16+,17-,18-/m1/s1 |
| InChIKey | QVQMPLATUBCZMQ-GVLSGGHMSA-N |
| Density | 1.256g/cm3 (Cal.) |
|---|---|
| Boiling point | 493.107°C at 760 mmHg (Cal.) |
| Flash point | 233.746°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,5(10)-Estratrien-3,15-alpha,17-beta-Triol |