|
CAS#: 57022-44-3 Product: N-[(2-Methyl-2-Propanyl)Oxy]-L-Alanine No suppilers available for the product. |
| Name | N-[(2-Methyl-2-Propanyl)Oxy]-L-Alanine |
|---|---|
| Synonyms | (S)-2-(tert-butoxyamino)propanoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 |
| CAS Registry Number | 57022-44-3 |
| SMILES | CC(C)(C)ON[C@@H](C)C(=O)O |
| InChI | 1S/C7H15NO3/c1-5(6(9)10)8-11-7(2,3)4/h5,8H,1-4H3,(H,9,10)/t5-/m0/s1 |
| InChIKey | OVGJPFXCBHGLNH-YFKPBYRVSA-N |
| Density | 1.045g/cm3 (Cal.) |
|---|---|
| Boiling point | 235.433°C at 760 mmHg (Cal.) |
| Flash point | 96.187°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[(2-Methyl-2-Propanyl)Oxy]-L-Alanine |