|
CAS#: 57055-38-6 Product: Monochlorodehydroabietic acid No suppilers available for the product. |
| Name | Monochlorodehydroabietic acid |
|---|---|
| Synonyms | Methyl (1R,4As,10Ar)-1-Chloro-7-Isopropyl-4A-Methyl-2,3,4,9,10,10A-Hexahydrophenanthrene-1-Carboxylate; (1R,4As,10Ar)-1-Chloro-7-Isopropyl-4A-Methyl-2,3,4,9,10,10A-Hexahydrophenanthrene-1-Carboxylic Acid Methyl Ester; 1-Phenanthrenecarboxylic Acid, Chloro-1,2,3,4,4A,9,10,10A-Octahydro-1,4A-Dimethyl-7-(1-Methylethyl)-, (1Theta-(1Alpha,4Abeta,10Aalpha))- |
| Molecular Structure | ![]() |
| Molecular Formula | C20H27ClO2 |
| Molecular Weight | 334.89 |
| CAS Registry Number | 57055-38-6 |
| SMILES | [C@]2(CCC[C@@]3(C1=C(C=C(C=C1)C(C)C)CC[C@@H]23)C)(C(=O)OC)Cl |
| InChI | 1S/C20H27ClO2/c1-13(2)14-6-8-16-15(12-14)7-9-17-19(16,3)10-5-11-20(17,21)18(22)23-4/h6,8,12-13,17H,5,7,9-11H2,1-4H3/t17-,19-,20-/m1/s1 |
| InChIKey | OUORCJOLWODUOZ-MISYRCLQSA-N |
| Density | 1.126g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.567°C at 760 mmHg (Cal.) |
| Flash point | 203.369°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Monochlorodehydroabietic acid |