|
CAS#: 57075-07-7 Product: Exo-3,3-Dimethylbicyclo[2.2.1]Heptane-2-Carbaldehyde No suppilers available for the product. |
| Name | Exo-3,3-Dimethylbicyclo[2.2.1]Heptane-2-Carbaldehyde |
|---|---|
| Synonyms | (1S,2R,4R)-3,3-Dimethylnorbornane-2-Carbaldehyde; (1S,2R,4R)-3,3-Dimethyl-2-Norbornanecarboxaldehyde |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 |
| CAS Registry Number | 57075-07-7 |
| EINECS | 260-549-9 |
| SMILES | [C@@H]1(C([C@@H]2CC[C@H]1C2)(C)C)C=O |
| InChI | 1S/C10H16O/c1-10(2)8-4-3-7(5-8)9(10)6-11/h6-9H,3-5H2,1-2H3/t7-,8+,9+/m0/s1 |
| InChIKey | VMKZLKWCFOWLCT-DJLDLDEBSA-N |
| Density | 1.013g/cm3 (Cal.) |
|---|---|
| Boiling point | 200.668°C at 760 mmHg (Cal.) |
| Flash point | 65.93°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Exo-3,3-Dimethylbicyclo[2.2.1]Heptane-2-Carbaldehyde |