|
CAS#: 57110-46-0 Product: Aciphyllic Acid No suppilers available for the product. |
| Name | Aciphyllic Acid |
|---|---|
| Synonyms | 2-[(5S,8S,8As)-3,8-Dimethyl-1,2,4,5,6,7,8,8A-Octahydroazulen-5-Yl]Acrylic Acid; Aciphyllic Acid; 5-Azuleneacetic Acid, 1,2,4,5,6,7,8,8A-Octahydro-3,8-Dimethyl-Alpha-Methylene-, (5S-(5Alpha,8Beta,8Aalpha))- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 |
| CAS Registry Number | 57110-46-0 |
| SMILES | [C@H]12C(=C(CC1)C)C[C@@H](C(C(=O)O)=C)CC[C@@H]2C |
| InChI | 1S/C15H22O2/c1-9-4-6-12(11(3)15(16)17)8-14-10(2)5-7-13(9)14/h9,12-13H,3-8H2,1-2H3,(H,16,17)/t9-,12-,13-/m0/s1 |
| InChIKey | HEIJYTOSZVGQPT-XDTLVQLUSA-N |
| Density | 1.051g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.069°C at 760 mmHg (Cal.) |
| Flash point | 280.032°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Aciphyllic Acid |