|
CAS#: 57128-29-7 Product: 2-(Napth-1-Yloxy)Propionic Acid No suppilers available for the product. |
| Name | 2-(Napth-1-Yloxy)Propionic Acid |
|---|---|
| Synonyms | (2R)-2-(1-Naphthyloxy)Propanoic Acid; (2R)-2-(1-Naphthyloxy)Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 |
| CAS Registry Number | 57128-29-7 |
| SMILES | [C@H](OC1=CC=CC2=C1C=CC=C2)(C(=O)O)C |
| InChI | 1S/C13H12O3/c1-9(13(14)15)16-12-8-4-6-10-5-2-3-7-11(10)12/h2-9H,1H3,(H,14,15)/t9-/m1/s1 |
| InChIKey | KTAVXDDWEGVLRN-SECBINFHSA-N |
| Density | 1.232g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.659°C at 760 mmHg (Cal.) |
| Flash point | 152.087°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Napth-1-Yloxy)Propionic Acid |