|
CAS#: 57134-72-2 Product: 1-[(2R,3S)-3-Phenyl-2-Oxiranyl]Ethanone No suppilers available for the product. |
| Name | 1-[(2R,3S)-3-Phenyl-2-Oxiranyl]Ethanone |
|---|---|
| Synonyms | 1-((2R,3S)-3-phenyloxiran-2-yl)ethanone |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.18 |
| CAS Registry Number | 57134-72-2 |
| SMILES | O=C([C@@H]2O[C@H]2c1ccccc1)C |
| InChI | 1S/C10H10O2/c1-7(11)9-10(12-9)8-5-3-2-4-6-8/h2-6,9-10H,1H3/t9-,10-/m0/s1 |
| InChIKey | IGCQIHCZUYCYAA-UWVGGRQHSA-N |
| Density | 1.161g/cm3 (Cal.) |
|---|---|
| Boiling point | 276.519°C at 760 mmHg (Cal.) |
| Flash point | 126.489°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(2R,3S)-3-Phenyl-2-Oxiranyl]Ethanone |