|
CAS#: 572-43-0 Product: (1E,2Z)-1,2-Diphenyl-1,2-Ethanedione Dioxime No suppilers available for the product. |
| Name | (1E,2Z)-1,2-Diphenyl-1,2-Ethanedione Dioxime |
|---|---|
| Synonyms | N-[(Z)-2-Nitroso-1,2-Di(Phenyl)Vinyl]Hydroxylamine; Alpha Ethanedione, Diphenyl-, Dioxime; Aids-018517 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 |
| CAS Registry Number | 572-43-0 |
| SMILES | C2=C(\C(NO)=C(N=O)/C1=CC=CC=C1)C=CC=C2 |
| InChI | 1S/C14H12N2O2/c17-15-13(11-7-3-1-4-8-11)14(16-18)12-9-5-2-6-10-12/h1-10,15,17H/b14-13- |
| InChIKey | ZXBLMXOUGVRCCH-YPKPFQOOSA-N |
| Density | 1.172g/cm3 (Cal.) |
|---|---|
| Boiling point | 393.292°C at 760 mmHg (Cal.) |
| Flash point | 191.656°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1E,2Z)-1,2-Diphenyl-1,2-Ethanedione Dioxime |