Online Database of Chemicals from Around the World
|
CAS#: 573-13-7 Product: 6-Methoxy-2,2-Dimethyl-2H-Benzo[h]Chromene No suppilers available for the product. |
| Name | 6-Methoxy-2,2-Dimethyl-2H-Benzo[h]Chromene |
|---|---|
| Synonyms | 6-Methoxy-2,2-Dimethyl-Benzo[H]Chromene; Lapachenole; 2H-Naphtho(1,2-B)Pyran, 6-Methoxy-2,2-Dimethyl- |
| Molecular Structure | ![CAS#: 573-13-7, 6-Methoxy-2,2-Dimethyl-2H-Benzo[h]Chromene](/moreStructures/573-13-7.gif) |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 |
| CAS Registry Number | 573-13-7 |
| SMILES | C2=C(OC)C1=CC=CC=C1C3=C2C=CC(O3)(C)C |
| InChI | 1S/C16H16O2/c1-16(2)9-8-11-10-14(17-3)12-6-4-5-7-13(12)15(11)18-16/h4-10H,1-3H3 |
| InChIKey | BFGQXXNDFKWDMA-UHFFFAOYSA-N |
| Density | 1.107g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.365°C at 760 mmHg (Cal.) |
| Flash point | 152.032°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methoxy-2,2-Dimethyl-2H-Benzo[h]Chromene |