| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | N-Methyl-N-(2-Methylphenyl)-Acetamide |
|---|---|
| Synonyms | N-Methyl-N-(2-Methylphenyl)Ethanamide; O-Acetotoluidide, N-Methyl- (8Ci); Ai3-10038 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 |
| CAS Registry Number | 573-26-2 |
| EINECS | 209-353-7 |
| SMILES | C1=CC(=C(C=C1)C)N(C(C)=O)C |
| InChI | 1S/C10H13NO/c1-8-6-4-5-7-10(8)11(3)9(2)12/h4-7H,1-3H3 |
| InChIKey | QKIDBCKIVIQWLL-UHFFFAOYSA-N |
| Density | 1.037g/cm3 (Cal.) |
|---|---|
| Boiling point | 260.611°C at 760 mmHg (Cal.) |
| Flash point | 111.201°C (Cal.) |
| (1) | Zhang-Wei Yan, Yu-Hao Li, Qi Xiao, Liang Zhao and Hong-Jun Zhu . N-Methyl-N-(2-methylphenyl)acetamide , Acta Cryst (2010). E66, o1679Â Â |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-Methyl-N-(2-Methylphenyl)-Acetamide |