|
CAS#: 57377-32-9 Product: Hymenoxon No suppilers available for the product. |
| Name | Hymenoxon |
|---|---|
| Synonyms | Hymenoxon; Furo(2',3':5,6)Cyclohepta(1,2-C)Pyran-2(3H)-One, Decahydro-5,7-Dihydroxy-4A,9-Dimethyl-3-Methylene-, (3Ar,4As,5R,7R,8Ar,9R,10Ar)-; Furo(2',3':5,6)Cyclohepta(1,2-C)Pyran-2(3H)-One, Decahydro-5,7-Dihydroxy-4A,9-Dimethyl-3-Methylene-, (3Ar-(3A-Alpha,4A-Beta,5-Alpha,7-Beta,8A-Alpha,9-Alpha,10A-Alpha))- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 |
| CAS Registry Number | 57377-32-9 |
| SMILES | [C@]13([C@@H](O[C@@H](O)C[C@H]1[C@@H](C[C@H]2OC(C([C@H]2C3)=C)=O)C)O)C |
| InChI | 1S/C15H22O5/c1-7-4-11-9(8(2)13(17)19-11)6-15(3)10(7)5-12(16)20-14(15)18/h7,9-12,14,16,18H,2,4-6H2,1,3H3/t7-,9-,10+,11-,12-,14-,15+/m1/s1 |
| InChIKey | PYINVOHSOZSEPB-DKGLCQEFSA-N |
| Density | 1.265g/cm3 (Cal.) |
|---|---|
| Boiling point | 487.881°C at 760 mmHg (Cal.) |
| Flash point | 182.472°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hymenoxon |