Online Database of Chemicals from Around the World
|
CAS#: 573966-55-9 Product: Dibenzo[b,d]Furan-2-Yl 3-Nitrobenzoate No suppilers available for the product. |
| Name | Dibenzo[b,d]Furan-2-Yl 3-Nitrobenzoate |
|---|---|
| Synonyms | 2-Dibenzofuranol,3-nitrobenzoate; ZINC06305014 |
| Molecular Structure | ![CAS#: 573966-55-9, Dibenzo[b,d]Furan-2-Yl 3-Nitrobenzoate](/moreStructures/573966-55-9.gif) |
| Molecular Formula | C19H11NO5 |
| Molecular Weight | 333.29 |
| CAS Registry Number | 573966-55-9 |
| SMILES | [O-][N+](=O)c1cccc(c1)C(=O)Oc3cc2c4ccccc4oc2cc3 |
| InChI | 1S/C19H11NO5/c21-19(12-4-3-5-13(10-12)20(22)23)24-14-8-9-18-16(11-14)15-6-1-2-7-17(15)25-18/h1-11H |
| InChIKey | DJTOTDMVVVENCJ-UHFFFAOYSA-N |
| Density | 1.414g/cm3 (Cal.) |
|---|---|
| Boiling point | 534.91°C at 760 mmHg (Cal.) |
| Flash point | 277.304°C (Cal.) |
| Refractive index | 1.713 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dibenzo[b,d]Furan-2-Yl 3-Nitrobenzoate |