|
CAS#: 57438-36-5 Product: 4'-Carboxyphenyl 4-Guanidinobenzoate No suppilers available for the product. |
| Name | 4'-Carboxyphenyl 4-Guanidinobenzoate |
|---|---|
| Synonyms | 4-(4-Guanidinobenzoyl)Oxybenzoic Acid; 4-[(4-Guanidinophenyl)-Oxomethoxy]Benzoic Acid; 4-[4-(Diaminomethylideneamino)Phenyl]Carbonyloxybenzoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C15H13N3O4 |
| Molecular Weight | 299.29 |
| CAS Registry Number | 57438-36-5 |
| SMILES | C1=C(C=CC(=C1)N=C(N)N)C(OC2=CC=C(C=C2)C(O)=O)=O |
| InChI | 1S/C15H13N3O4/c16-15(17)18-11-5-1-10(2-6-11)14(21)22-12-7-3-9(4-8-12)13(19)20/h1-8H,(H,19,20)(H4,16,17,18) |
| InChIKey | BYYHNSYDTLKWGL-UHFFFAOYSA-N |
| Density | 1.401g/cm3 (Cal.) |
|---|---|
| Boiling point | 583.111°C at 760 mmHg (Cal.) |
| Flash point | 306.454°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4'-Carboxyphenyl 4-Guanidinobenzoate |