|
CAS#: 57491-68-6 Product: 2,2'-[Methylenebis(Thio)]Dianiline No suppilers available for the product. |
| Name | 2,2'-[Methylenebis(Thio)]Dianiline |
|---|---|
| Synonyms | 2-[[(2-Aminophenyl)Thio]Methylthio]Aniline; [2-[[(2-Aminophenyl)Thio]Methylthio]Phenyl]Amine; 1,1'-Bis(2-Aminophenylthio)Methane |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14N2S2 |
| Molecular Weight | 262.39 |
| CAS Registry Number | 57491-68-6 |
| EINECS | 260-769-5 |
| SMILES | C1=C(C(=CC=C1)N)SCSC2=C(C=CC=C2)N |
| InChI | 1S/C13H14N2S2/c14-10-5-1-3-7-12(10)16-9-17-13-8-4-2-6-11(13)15/h1-8H,9,14-15H2 |
| InChIKey | NBZBEJOKMAJWOQ-UHFFFAOYSA-N |
| Density | 1.302g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.716°C at 760 mmHg (Cal.) |
| Flash point | 220.942°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-[Methylenebis(Thio)]Dianiline |