|
CAS#: 57533-87-6 Product: 3,7-Dihydro-1,3-Dimethyl-1H-Purine-2,6-Dione, Potassium Salt No suppilers available for the product. |
| Name | 3,7-Dihydro-1,3-Dimethyl-1H-Purine-2,6-Dione, Potassium Salt |
|---|---|
| Synonyms | Potassium Theophylline; 3,7-Dihydro-1,3-Dimethyl-1H-Purine-2,6-Dione, Potassium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C7H8KN4O2 |
| Molecular Weight | 219.26 |
| CAS Registry Number | 57533-87-6 |
| EINECS | 260-798-3 |
| SMILES | C1=NC2=C([NH]1)C(=O)N(C(=O)N2C)C.[K+] |
| InChI | 1S/C7H8N4O2.K/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;/h3H,1-2H3,(H,8,9);/q;+1 |
| InChIKey | AYOJGYLLBVGRNI-UHFFFAOYSA-N |
| Boiling point | 454.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 228.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,7-Dihydro-1,3-Dimethyl-1H-Purine-2,6-Dione, Potassium Salt |