Online Database of Chemicals from Around the World
|
CAS#: 57543-83-6 Product: 3-Nitro-2,6,7-Trimethyl-2H-1-Benzopyran No suppilers available for the product. |
| Name | 3-Nitro-2,6,7-Trimethyl-2H-1-Benzopyran |
|---|---|
| Synonyms | 2H-1-Benzopyran, 3-Nitro-2,6,7-Trimethyl-; 3-Nitro-2,6,7-Trimethyl-2H-1-Benzopyran; 5-17-02-00074 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 |
| CAS Registry Number | 57543-83-6 |
| SMILES | C1=C(C(=CC2=C1C=C([N+]([O-])=O)C(O2)C)C)C |
| InChI | 1S/C12H13NO3/c1-7-4-10-6-11(13(14)15)9(3)16-12(10)5-8(7)2/h4-6,9H,1-3H3 |
| InChIKey | DRQBSLQRAKLDGC-UHFFFAOYSA-N |
| Density | 1.212g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.911°C at 760 mmHg (Cal.) |
| Flash point | 154.28°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Nitro-2,6,7-Trimethyl-2H-1-Benzopyran |